C12H14N2O3 — CID 165143384
1-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]ethanone (PubChem CID 165143384) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 1-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]ethanone.
| Compound Name | 1-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]ethanone |
|---|---|
| PubChem CID | 165143384 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]ethanone |
| SMILES | COCCOc1ccn2c(C(C)=O)cnc2c1 |
| InChI | InChI=1S/C12H14N2O3/c1-9(15)11-8-13-12-7-10(3-4-14(11)12)17-6-5-16-2/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | AIZCYAIEYADASW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|