C62H48F3N3O3S — CID 165148895
[2-[2-[3,5-bis[2-[4-(5-methyl-2-pyridinyl)phenyl]ethyl]phenyl]phenyl]-5-(4-phenylquinolin-2-yl)phenyl] trifluoromethanesulfonate (PubChem CID 165148895) has the molecular formula C62H48F3N3O3S and a molecular weight of 972.14 g/mol. Its IUPAC name is [2-[2-[3,5-bis[2-[4-(5-methyl-2-pyridinyl)phenyl]ethyl]phenyl]phenyl]-5-(4-phenylquinolin-2-yl)phenyl] trifluoromethanesulfonate.
| Compound Name | [2-[2-[3,5-bis[2-[4-(5-methyl-2-pyridinyl)phenyl]ethyl]phenyl]phenyl]-5-(4-phenylquinolin-2-yl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 165148895 |
| Molecular Formula | C62H48F3N3O3S |
| Molecular Weight | 972.14 g/mol |
| Exact Mass | 971.34 |
| IUPAC Name | [2-[2-[3,5-bis[2-[4-(5-methyl-2-pyridinyl)phenyl]ethyl]phenyl]phenyl]-5-(4-phenylquinolin-2-yl)phenyl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(-c2ccc(CCc3cc(CCc4ccc(-c5ccc(C)cn5)cc4)cc(-c4ccccc4-c4ccc(-c5cc(-c6ccccc6)c6ccccc6n5)cc4OS(=O)(=O)C(F)(F)F)c3)cc2)nc1 |
| InChI | InChI=1S/C62H48F3N3O3S/c1-41-16-32-57(66-39-41)48-26-22-43(23-27-48)18-20-45-34-46(21-19-44-24-28-49(29-25-44)58-33-17-42(2)40-67-58)36-51(35-45)52-12-6-7-13-53(52)55-31-30-50(37-61(55)71-72(69,70)62(63,64)65)60-38-56(47-10-4-3-5-11-47)54-14-8-9-15-59(54)68-60/h3-17,22-40H,18-21H2,1-2H3 |
| InChIKey | UCVDVESETXNGDY-UHFFFAOYSA-N |
| XLogP | 15.44 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 972.14 |
| LogP ≤ 5 | 15.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|