C8H8N4O — CID 165150028
6-amino-3-methylpyrido[3,2-d]pyrimidin-4-one (PubChem CID 165150028) has the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. Its IUPAC name is 6-amino-3-methylpyrido[3,2-d]pyrimidin-4-one.
| Compound Name | 6-amino-3-methylpyrido[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 165150028 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 6-amino-3-methylpyrido[3,2-d]pyrimidin-4-one |
| SMILES | Cn1cnc2ccc(N)nc2c1=O |
| InChI | InChI=1S/C8H8N4O/c1-12-4-10-5-2-3-6(9)11-7(5)8(12)13/h2-4H,1H3,(H2,9,11) |
| InChIKey | QEHHTCMEEGPLOE-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |