C19H28N6O2S — CID 165152623
N-[2-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxyethyl]-2-(methylamino)propanamide (PubChem CID 165152623) has the molecular formula C19H28N6O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is N-[2-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxyethyl]-2-(methylamino)propanamide.
| Compound Name | N-[2-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxyethyl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 165152623 |
| Molecular Formula | C19H28N6O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-[2-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxyethyl]-2-(methylamino)propanamide |
| SMILES | CCc1nc(Nc2ncc(C3CCC3)s2)cc(OCCNC(=O)C(C)NC)n1 |
| InChI | InChI=1S/C19H28N6O2S/c1-4-15-23-16(25-19-22-11-14(28-19)13-6-5-7-13)10-17(24-15)27-9-8-21-18(26)12(2)20-3/h10-13,20H,4-9H2,1-3H3,(H,21,26)(H,22,23,24,25) |
| InChIKey | WCGIBZMLLQRFCZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|