C25H30F3N5OS — CID 16515534
2-[[4-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]ethanone (PubChem CID 16515534) has the molecular formula C25H30F3N5OS and a molecular weight of 505.61 g/mol. Its IUPAC name is 2-[[4-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]ethanone.
| Compound Name | 2-[[4-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 16515534 |
| Molecular Formula | C25H30F3N5OS |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 2-[[4-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]ethanone |
| SMILES | Cc1cc(C(=O)CSc2nnc(CN3CCCCC3)n2Cc2ccccc2)c(C)n1CC(F)(F)F |
| InChI | InChI=1S/C25H30F3N5OS/c1-18-13-21(19(2)33(18)17-25(26,27)28)22(34)16-35-24-30-29-23(15-31-11-7-4-8-12-31)32(24)14-20-9-5-3-6-10-20/h3,5-6,9-10,13H,4,7-8,11-12,14-17H2,1-2H3 |
| InChIKey | MIEVPRRUPBHIJF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |