C18H23N5S — CID 30548685
3-[[4-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile (PubChem CID 30548685) has the molecular formula C18H23N5S and a molecular weight of 341.48 g/mol. Its IUPAC name is 3-[[4-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile.
| Compound Name | 3-[[4-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile |
|---|---|
| PubChem CID | 30548685 |
| Molecular Formula | C18H23N5S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 3-[[4-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile |
| SMILES | N#CCCSc1nnc(CN2CCCCC2)n1Cc1ccccc1 |
| InChI | InChI=1S/C18H23N5S/c19-10-7-13-24-18-21-20-17(15-22-11-5-2-6-12-22)23(18)14-16-8-3-1-4-9-16/h1,3-4,8-9H,2,5-7,11-15H2 |
| InChIKey | ZKHKCGWAZMCVSF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 57.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|