C19H29N5O2S2 — CID 56529090
3-[[4-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-methylpropane-1-sulfonamide (PubChem CID 56529090) has the molecular formula C19H29N5O2S2 and a molecular weight of 423.61 g/mol. Its IUPAC name is 3-[[4-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-methylpropane-1-sulfonamide.
| Compound Name | 3-[[4-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 56529090 |
| Molecular Formula | C19H29N5O2S2 |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-[[4-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-methylpropane-1-sulfonamide |
| SMILES | CNS(=O)(=O)CCCSc1nnc(CN2CCCCC2)n1Cc1ccccc1 |
| InChI | InChI=1S/C19H29N5O2S2/c1-20-28(25,26)14-8-13-27-19-22-21-18(16-23-11-6-3-7-12-23)24(19)15-17-9-4-2-5-10-17/h2,4-5,9-10,20H,3,6-8,11-16H2,1H3 |
| InChIKey | IZHBOMGDDDYCTJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|