C28H20N2O2SeSi — CID 165155653
2-[(13,13-dimethyl-3-selena-1,18-diaza-13-silapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8(20),9,11,14(19),15,17-octaen-4-yl)methylidene]indene-1,3-dione (PubChem CID 165155653) has the molecular formula C28H20N2O2SeSi and a molecular weight of 523.53 g/mol. Its IUPAC name is 2-[(13,13-dimethyl-3-selena-1,18-diaza-13-silapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8(20),9,11,14(19),15,17-octaen-4-yl)methylidene]indene-1,3-dione.
| Compound Name | 2-[(13,13-dimethyl-3-selena-1,18-diaza-13-silapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8(20),9,11,14(19),15,17-octaen-4-yl)methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 165155653 |
| Molecular Formula | C28H20N2O2SeSi |
| Molecular Weight | 523.53 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | 2-[(13,13-dimethyl-3-selena-1,18-diaza-13-silapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8(20),9,11,14(19),15,17-octaen-4-yl)methylidene]indene-1,3-dione |
| SMILES | C[Si]1(C)c2cccnc2N2c3[se]c(C=C4C(=O)c5ccccc5C4=O)cc3Cc3cccc1c32 |
| InChI | InChI=1S/C28H20N2O2SeSi/c1-34(2)22-10-5-7-16-13-17-14-18(15-21-25(31)19-8-3-4-9-20(19)26(21)32)33-28(17)30(24(16)22)27-23(34)11-6-12-29-27/h3-12,14-15H,13H2,1-2H3 |
| InChIKey | MQUMAQLSFZPJBE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|