C20H38O2Si — CID 165155744
(E)-2-methyl-3-[3-[2-tri(propan-2-yl)silyloxyethyl]-1-bicyclo[1.1.1]pentanyl]prop-2-en-1-ol (PubChem CID 165155744) has the molecular formula C20H38O2Si and a molecular weight of 338.61 g/mol. Its IUPAC name is (E)-2-methyl-3-[3-[2-tri(propan-2-yl)silyloxyethyl]-1-bicyclo[1.1.1]pentanyl]prop-2-en-1-ol.
| Compound Name | (E)-2-methyl-3-[3-[2-tri(propan-2-yl)silyloxyethyl]-1-bicyclo[1.1.1]pentanyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 165155744 |
| Molecular Formula | C20H38O2Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | (E)-2-methyl-3-[3-[2-tri(propan-2-yl)silyloxyethyl]-1-bicyclo[1.1.1]pentanyl]prop-2-en-1-ol |
| SMILES | C/C(=C\C12CC(CCO[Si](C(C)C)(C(C)C)C(C)C)(C1)C2)CO |
| InChI | InChI=1S/C20H38O2Si/c1-15(2)23(16(3)4,17(5)6)22-9-8-19-12-20(13-19,14-19)10-18(7)11-21/h10,15-17,21H,8-9,11-14H2,1-7H3/b18-10+ |
| InChIKey | POYIEIRBKMVCMA-VCHYOVAHSA-N |
| XLogP | 5.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|