About N-[(2R)-4,4-dimethylpentan-2-yl]-3-methyl-4H-benzo[f]isoquinolin-4-amine
N-[(2R)-4,4-dimethylpentan-2-yl]-3-methyl-4H-benzo[f]isoquinolin-4-amine (PubChem CID 165160878) has the molecular formula C21H28N2
and a molecular weight of 308.47 g/mol. Its IUPAC name is N-[(2R)-4,4-dimethylpentan-2-yl]-3-methyl-4H-benzo[f]isoquinolin-4-amine.
Molecular Properties
| Compound Name | N-[(2R)-4,4-dimethylpentan-2-yl]-3-methyl-4H-benzo[f]isoquinolin-4-amine |
| PubChem CID | 165160878 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | N-[(2R)-4,4-dimethylpentan-2-yl]-3-methyl-4H-benzo[f]isoquinolin-4-amine |
| SMILES | C[C@H](CC(C)(C)C)NC1c2ccc3ccccc3c2C=CN1C |
| InChI | InChI=1S/C21H28N2/c1-15(14-21(2,3)4)22-20-19-11-10-16-8-6-7-9-17(16)18(19)12-13-23(20)5/h6-13,15,20,22H,14H2,1-5H3/t15-,20?/m1/s1 |
| InChIKey | VIYWTDPUNQZPMN-IWPPFLRJSA-N |
| XLogP | 5.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2R)-4,4-dimethylpentan-2-yl]-3-methyl-4H-benzo[f]isoquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-4,4-dimethylpentan-2-yl]-3-methyl-4H-benzo[f]isoquinolin-4-amine?
The IUPAC name of N-[(2R)-4,4-dimethylpentan-2-yl]-3-methyl-4H-benzo[f]isoquinolin-4-amine (CID 165160878) is N-[(2R)-4,4-dimethylpentan-2-yl]-3-methyl-4H-benzo[f]isoquinolin-4-amine.
What is the SMILES notation for N-[(2R)-4,4-dimethylpentan-2-yl]-3-methyl-4H-benzo[f]isoquinolin-4-amine?
The canonical SMILES for N-[(2R)-4,4-dimethylpentan-2-yl]-3-methyl-4H-benzo[f]isoquinolin-4-amine is C[C@H](CC(C)(C)C)NC1c2ccc3ccccc3c2C=CN1C.
What is the InChIKey of N-[(2R)-4,4-dimethylpentan-2-yl]-3-methyl-4H-benzo[f]isoquinolin-4-amine?
The InChIKey is VIYWTDPUNQZPMN-IWPPFLRJSA-N. The full InChI is InChI=1S/C21H28N2/c1-15(14-21(2,3)4)22-20-19-11-10-16-8-6-7-9-17(16)18(19)12-13-23(20)5/h6-13,15,20,22H,14H2,1-5H3/t15-,20?/m1/s1.
What are the key properties of N-[(2R)-4,4-dimethylpentan-2-yl]-3-methyl-4H-benzo[f]isoquinolin-4-amine?
N-[(2R)-4,4-dimethylpentan-2-yl]-3-methyl-4H-benzo[f]isoquinolin-4-amine has a molecular weight of 308.47 g/mol, XLogP of 5.17, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-4,4-dimethylpentan-2-yl]-3-methyl-4H-benzo[f]isoquinolin-4-amine is sourced from PubChem (CID 165160878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).