C14H30N2O3 — CID 165163189
(2S)-4-(dimethylamino)-6-[2-(dimethylamino)-1-hydroxyethyl]-2-propan-2-yloxan-3-ol (PubChem CID 165163189) has the molecular formula C14H30N2O3 and a molecular weight of 274.41 g/mol. Its IUPAC name is (2S)-4-(dimethylamino)-6-[2-(dimethylamino)-1-hydroxyethyl]-2-propan-2-yloxan-3-ol.
| Compound Name | (2S)-4-(dimethylamino)-6-[2-(dimethylamino)-1-hydroxyethyl]-2-propan-2-yloxan-3-ol |
|---|---|
| PubChem CID | 165163189 |
| Molecular Formula | C14H30N2O3 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (2S)-4-(dimethylamino)-6-[2-(dimethylamino)-1-hydroxyethyl]-2-propan-2-yloxan-3-ol |
| SMILES | CC(C)[C@@H]1OC(C(O)CN(C)C)CC(N(C)C)C1O |
| InChI | InChI=1S/C14H30N2O3/c1-9(2)14-13(18)10(16(5)6)7-12(19-14)11(17)8-15(3)4/h9-14,17-18H,7-8H2,1-6H3/t10?,11?,12?,13?,14-/m0/s1 |
| InChIKey | QIMMWSPTCTYYHY-JVUSGKFHSA-N |
| XLogP | 0.01 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |