C48H32N4S — CID 165165946
1,2,4,7,8,10-hexadeuterio-5-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-11,11-dimethylindeno[1,2-b]carbazole (PubChem CID 165165946) has the molecular formula C48H32N4S and a molecular weight of 702.92 g/mol. Its IUPAC name is 1,2,4,7,8,10-hexadeuterio-5-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-11,11-dimethylindeno[1,2-b]carbazole.
| Compound Name | 1,2,4,7,8,10-hexadeuterio-5-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-11,11-dimethylindeno[1,2-b]carbazole |
|---|---|
| PubChem CID | 165165946 |
| Molecular Formula | C48H32N4S |
| Molecular Weight | 702.92 g/mol |
| Exact Mass | 702.27 |
| IUPAC Name | 1,2,4,7,8,10-hexadeuterio-5-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-11,11-dimethylindeno[1,2-b]carbazole |
| SMILES | [2H]c1cc([2H])c2c(c1[2H])-c1cc3c(cc1C2(C)C)c1c([2H])c([2H])cc([2H])c1n3-c1cccc2c1sc1cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc12 |
| InChI | InChI=1S/C48H32N4S/c1-48(2)38-21-11-9-18-32(38)36-28-42-37(27-39(36)48)33-19-10-12-22-40(33)52(42)41-23-13-20-35-34-25-24-31(26-43(34)53-44(35)41)47-50-45(29-14-5-3-6-15-29)49-46(51-47)30-16-7-4-8-17-30/h3-28H,1-2H3/i9D,10D,18D,19D,21D,22D |
| InChIKey | XMLOPJFVOAWXEY-AXBKTVENSA-N |
| XLogP | 12.64 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.92 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |