C6H8NO5PS — CID 165166379
(2-acetyl-1,3-thiazol-4-yl)methyl dihydrogen phosphate (PubChem CID 165166379) has the molecular formula C6H8NO5PS and a molecular weight of 237.17 g/mol. Its IUPAC name is (2-acetyl-1,3-thiazol-4-yl)methyl dihydrogen phosphate.
| Compound Name | (2-acetyl-1,3-thiazol-4-yl)methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 165166379 |
| Molecular Formula | C6H8NO5PS |
| Molecular Weight | 237.17 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | (2-acetyl-1,3-thiazol-4-yl)methyl dihydrogen phosphate |
| SMILES | CC(=O)c1nc(COP(=O)(O)O)cs1 |
| InChI | InChI=1S/C6H8NO5PS/c1-4(8)6-7-5(3-14-6)2-12-13(9,10)11/h3H,2H2,1H3,(H2,9,10,11) |
| InChIKey | OZPNVTXCGOJVCJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.17 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|