C6H9N2O5PS — CID 165166380
[2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-1,3-thiazol-4-yl]methyl dihydrogen phosphate (PubChem CID 165166380) has the molecular formula C6H9N2O5PS and a molecular weight of 252.19 g/mol. Its IUPAC name is [2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-1,3-thiazol-4-yl]methyl dihydrogen phosphate.
| Compound Name | [2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-1,3-thiazol-4-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 165166380 |
| Molecular Formula | C6H9N2O5PS |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | [2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-1,3-thiazol-4-yl]methyl dihydrogen phosphate |
| SMILES | C/C(=N/O)c1nc(COP(=O)(O)O)cs1 |
| InChI | InChI=1S/C6H9N2O5PS/c1-4(8-9)6-7-5(3-15-6)2-13-14(10,11)12/h3,9H,2H2,1H3,(H2,10,11,12)/b8-4- |
| InChIKey | XLXINSJNOPJKOU-YWEYNIOJSA-N |
| XLogP | 0.95 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|