C21H16F2N4O5 — CID 165167066
3-(difluoromethoxy)-1-[(4-methoxyphenyl)methyl]-5-(4-nitrophenoxy)pyrazolo[5,4-b]pyridine (PubChem CID 165167066) has the molecular formula C21H16F2N4O5 and a molecular weight of 442.38 g/mol. Its IUPAC name is 3-(difluoromethoxy)-1-[(4-methoxyphenyl)methyl]-5-(4-nitrophenoxy)pyrazolo[5,4-b]pyridine.
| Compound Name | 3-(difluoromethoxy)-1-[(4-methoxyphenyl)methyl]-5-(4-nitrophenoxy)pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 165167066 |
| Molecular Formula | C21H16F2N4O5 |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 3-(difluoromethoxy)-1-[(4-methoxyphenyl)methyl]-5-(4-nitrophenoxy)pyrazolo[5,4-b]pyridine |
| SMILES | COc1ccc(Cn2nc(OC(F)F)c3cc(Oc4ccc([N+](=O)[O-])cc4)cnc32)cc1 |
| InChI | InChI=1S/C21H16F2N4O5/c1-30-15-6-2-13(3-7-15)12-26-19-18(20(25-26)32-21(22)23)10-17(11-24-19)31-16-8-4-14(5-9-16)27(28)29/h2-11,21H,12H2,1H3 |
| InChIKey | BBSRWXQFOAUGSJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 101.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|