C27H20F3N3O4S — CID 165167137
3-[4-(6,7-dimethoxyquinolin-4-yl)sulfanylphenyl]-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione (PubChem CID 165167137) has the molecular formula C27H20F3N3O4S and a molecular weight of 539.54 g/mol. Its IUPAC name is 3-[4-(6,7-dimethoxyquinolin-4-yl)sulfanylphenyl]-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 3-[4-(6,7-dimethoxyquinolin-4-yl)sulfanylphenyl]-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 165167137 |
| Molecular Formula | C27H20F3N3O4S |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | 3-[4-(6,7-dimethoxyquinolin-4-yl)sulfanylphenyl]-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
| SMILES | COc1cc2nccc(Sc3ccc(N4C(=O)CN(c5cccc(C(F)(F)F)c5)C4=O)cc3)c2cc1OC |
| InChI | InChI=1S/C27H20F3N3O4S/c1-36-22-13-20-21(14-23(22)37-2)31-11-10-24(20)38-19-8-6-17(7-9-19)33-25(34)15-32(26(33)35)18-5-3-4-16(12-18)27(28,29)30/h3-14H,15H2,1-2H3 |
| InChIKey | DHWDNQPLLXKHKR-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|