C54H33NO — CID 165169914
9-[2-[3-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)naphthalen-1-yl]dibenzofuran-4-yl]carbazole (PubChem CID 165169914) has the molecular formula C54H33NO and a molecular weight of 719.91 g/mol. Its IUPAC name is 9-[2-[3-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)naphthalen-1-yl]dibenzofuran-4-yl]carbazole.
| Compound Name | 9-[2-[3-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)naphthalen-1-yl]dibenzofuran-4-yl]carbazole |
|---|---|
| PubChem CID | 165169914 |
| Molecular Formula | C54H33NO |
| Molecular Weight | 719.91 g/mol |
| Exact Mass | 719.31 |
| IUPAC Name | 9-[2-[3-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)naphthalen-1-yl]dibenzofuran-4-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cc(-c4cc(-n5c6ccccc6c6ccccc65)c5oc6ccccc6c5c4)c4ccccc4c3)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccccc3)c2c1[2H] |
| InChI | InChI=1S/C54H33NO/c1-2-16-34(17-3-1)52-42-23-6-8-25-44(42)53(45-26-9-7-24-43(45)52)37-30-35-18-4-5-19-38(35)46(32-37)36-31-47-41-22-12-15-29-51(41)56-54(47)50(33-36)55-48-27-13-10-20-39(48)40-21-11-14-28-49(40)55/h1-33H/i6D,7D,8D,9D,23D,24D,25D,26D |
| InChIKey | UFFTVUFUBSIMCJ-UIIICJRWSA-N |
| XLogP | 15.14 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.91 |
| LogP ≤ 5 | 15.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|