C54H28B5NO — CID 174140743
CID 174140743 (PubChem CID 174140743) has the molecular formula C54H28B5NO and a molecular weight of 760.88 g/mol.
| Compound Name | CID 174140743 |
|---|---|
| PubChem CID | 174140743 |
| Molecular Formula | C54H28B5NO |
| Molecular Weight | 760.88 g/mol |
| Exact Mass | 761.26 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2c3ccccc3c(-c3cc(-c4cc(-n5c6ccccc6c6ccccc65)c5oc6ccccc6c5c4)c4ccccc4c3)c3ccccc23)c([B])c1[B] |
| InChI | InChI=1S/C54H28B5NO/c55-49-48(50(56)52(58)53(59)51(49)57)47-38-20-5-3-18-36(38)46(37-19-4-6-21-39(37)47)31-25-29-13-1-2-14-32(29)40(27-31)30-26-41-35-17-9-12-24-45(35)61-54(41)44(28-30)60-42-22-10-7-15-33(42)34-16-8-11-23-43(34)60/h1-28H |
| InChIKey | DIQSBAOISPYWPD-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.88 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|