C20H14N2S — CID 165170193
16,18-dimethyl-2-thia-10,17-diazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(21),3,5,7,9,11,13,15,17,19-decaene (PubChem CID 165170193) has the molecular formula C20H14N2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 16,18-dimethyl-2-thia-10,17-diazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(21),3,5,7,9,11,13,15,17,19-decaene.
| Compound Name | 16,18-dimethyl-2-thia-10,17-diazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(21),3,5,7,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 165170193 |
| Molecular Formula | C20H14N2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 16,18-dimethyl-2-thia-10,17-diazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(21),3,5,7,9,11,13,15,17,19-decaene |
| SMILES | Cc1cc2c(cc3c4c(nccc42)-c2ccccc2S3)c(C)n1 |
| InChI | InChI=1S/C20H14N2S/c1-11-9-16-13-7-8-21-20-14-5-3-4-6-17(14)23-18(19(13)20)10-15(16)12(2)22-11/h3-10H,1-2H3 |
| InChIKey | VKCSYNDOIXOHNI-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|