C23H20N2 — CID 165170266
4,6,20,20-tetramethyl-5,12-diazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(21),2,4,6,8,10,12,14,16,18-decaene (PubChem CID 165170266) has the molecular formula C23H20N2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 4,6,20,20-tetramethyl-5,12-diazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(21),2,4,6,8,10,12,14,16,18-decaene.
| Compound Name | 4,6,20,20-tetramethyl-5,12-diazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(21),2,4,6,8,10,12,14,16,18-decaene |
|---|---|
| PubChem CID | 165170266 |
| Molecular Formula | C23H20N2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4,6,20,20-tetramethyl-5,12-diazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(21),2,4,6,8,10,12,14,16,18-decaene |
| SMILES | Cc1cc2c(cc3c4c(nccc42)-c2ccccc2C3(C)C)c(C)n1 |
| InChI | InChI=1S/C23H20N2/c1-13-11-18-15-9-10-24-22-16-7-5-6-8-19(16)23(3,4)20(21(15)22)12-17(18)14(2)25-13/h5-12H,1-4H3 |
| InChIKey | YUPYCDLRFLQNSN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|