C24H17Cl2F2N9O — CID 165172143
3-chloro-5-[1-[3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-1-oxido-5,6,7,8-tetrahydroquinolin-1-ium-8-yl]pyrazol-4-yl]-6-fluoropyridin-2-amine (PubChem CID 165172143) has the molecular formula C24H17Cl2F2N9O and a molecular weight of 556.36 g/mol. Its IUPAC name is 3-chloro-5-[1-[3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-1-oxido-5,6,7,8-tetrahydroquinolin-1-ium-8-yl]pyrazol-4-yl]-6-fluoropyridin-2-amine.
| Compound Name | 3-chloro-5-[1-[3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-1-oxido-5,6,7,8-tetrahydroquinolin-1-ium-8-yl]pyrazol-4-yl]-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 165172143 |
| Molecular Formula | C24H17Cl2F2N9O |
| Molecular Weight | 556.36 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | 3-chloro-5-[1-[3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-1-oxido-5,6,7,8-tetrahydroquinolin-1-ium-8-yl]pyrazol-4-yl]-6-fluoropyridin-2-amine |
| SMILES | Nc1nc(F)c(-c2cnn(C3CCCc4cc(-c5c(-n6cnnn6)ccc(Cl)c5F)c[n+]([O-])c43)c2)cc1Cl |
| InChI | InChI=1S/C24H17Cl2F2N9O/c25-16-4-5-18(36-11-30-33-34-36)20(21(16)27)13-6-12-2-1-3-19(22(12)37(38)10-13)35-9-14(8-31-35)15-7-17(26)24(29)32-23(15)28/h4-11,19H,1-3H2,(H2,29,32) |
| InChIKey | WMZAMZJEJLZTGD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 127.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|