C21H23FN6O3S — CID 16517350
2-[5-(4-fluorophenyl)tetrazol-2-yl]-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 16517350) has the molecular formula C21H23FN6O3S and a molecular weight of 458.52 g/mol. Its IUPAC name is 2-[5-(4-fluorophenyl)tetrazol-2-yl]-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[5-(4-fluorophenyl)tetrazol-2-yl]-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 16517350 |
| Molecular Formula | C21H23FN6O3S |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 2-[5-(4-fluorophenyl)tetrazol-2-yl]-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2nnc(-c3ccc(F)cc3)n2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H23FN6O3S/c1-15-5-10-18(13-19(15)32(30,31)27-11-3-2-4-12-27)23-20(29)14-28-25-21(24-26-28)16-6-8-17(22)9-7-16/h5-10,13H,2-4,11-12,14H2,1H3,(H,23,29) |
| InChIKey | DXKAMYNVGPCWHU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |