C26H33ClFN7O3 — CID 165174789
tert-butyl 4-[[[5-(2-chloro-4-pyridinyl)-4,13-dimethyl-10-oxa-3,6,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-8-yl]amino]methyl]-4-fluoropiperidine-1-carboxylate (PubChem CID 165174789) has the molecular formula C26H33ClFN7O3 and a molecular weight of 546.05 g/mol. Its IUPAC name is tert-butyl 4-[[[5-(2-chloro-4-pyridinyl)-4,13-dimethyl-10-oxa-3,6,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-8-yl]amino]methyl]-4-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[5-(2-chloro-4-pyridinyl)-4,13-dimethyl-10-oxa-3,6,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-8-yl]amino]methyl]-4-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 165174789 |
| Molecular Formula | C26H33ClFN7O3 |
| Molecular Weight | 546.05 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | tert-butyl 4-[[[5-(2-chloro-4-pyridinyl)-4,13-dimethyl-10-oxa-3,6,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-8-yl]amino]methyl]-4-fluoropiperidine-1-carboxylate |
| SMILES | Cc1nc2c3c(c(NCC4(F)CCN(C(=O)OC(C)(C)C)CC4)nn2c1-c1ccnc(Cl)c1)OCCN3C |
| InChI | InChI=1S/C26H33ClFN7O3/c1-16-19(17-6-9-29-18(27)14-17)35-23(31-16)20-21(37-13-12-33(20)5)22(32-35)30-15-26(28)7-10-34(11-8-26)24(36)38-25(2,3)4/h6,9,14H,7-8,10-13,15H2,1-5H3,(H,30,32) |
| InChIKey | IIGCAEDHQPCBAX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.05 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|