C12H13N3O3 — CID 165178715
2-methyl-6-[(3S)-oxolan-3-yl]oxy-3H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 165178715) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 2-methyl-6-[(3S)-oxolan-3-yl]oxy-3H-pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-methyl-6-[(3S)-oxolan-3-yl]oxy-3H-pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 165178715 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-methyl-6-[(3S)-oxolan-3-yl]oxy-3H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | Cc1nc2cnc(O[C@H]3CCOC3)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C12H13N3O3/c1-7-14-10-5-13-11(4-9(10)12(16)15-7)18-8-2-3-17-6-8/h4-5,8H,2-3,6H2,1H3,(H,14,15,16)/t8-/m0/s1 |
| InChIKey | BFQSKOXPZQFXRU-QMMMGPOBSA-N |
| XLogP | 0.79 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |