C34H62NO7P — CID 165182636
[3-decoxy-2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 165182636) has the molecular formula C34H62NO7P and a molecular weight of 627.84 g/mol. Its IUPAC name is [3-decoxy-2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-decoxy-2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 165182636 |
| Molecular Formula | C34H62NO7P |
| Molecular Weight | 627.84 g/mol |
| Exact Mass | 627.43 |
| IUPAC Name | [3-decoxy-2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(COCCCCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C34H62NO7P/c1-6-8-10-12-14-16-17-18-19-20-21-23-25-27-34(36)42-33(31-39-29-26-24-22-15-13-11-9-7-2)32-41-43(37,38)40-30-28-35(3,4)5/h8,10,14,16,18-19,21,23,33H,6-7,9,11-13,15,17,20,22,24-32H2,1-5H3/b10-8-,16-14-,19-18-,23-21- |
| InChIKey | AHULHRQIDRSPFN-ZSHCVBGVSA-N |
| XLogP | 7.85 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.84 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|