C37H66NO7P — CID 165289530
[2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxy-3-[(Z)-tridec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 165289530) has the molecular formula C37H66NO7P and a molecular weight of 667.91 g/mol. Its IUPAC name is [2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxy-3-[(Z)-tridec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxy-3-[(Z)-tridec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 165289530 |
| Molecular Formula | C37H66NO7P |
| Molecular Weight | 667.91 g/mol |
| Exact Mass | 667.46 |
| IUPAC Name | [2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxy-3-[(Z)-tridec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(COCCCCCCCC/C=C\CCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C37H66NO7P/c1-6-8-10-12-14-16-18-19-20-22-24-26-28-30-37(39)45-36(35-44-46(40,41)43-33-31-38(3,4)5)34-42-32-29-27-25-23-21-17-15-13-11-9-7-2/h8,10-11,13-14,16,19-20,24,26,36H,6-7,9,12,15,17-18,21-23,25,27-35H2,1-5H3/b10-8-,13-11-,16-14-,20-19-,26-24- |
| InChIKey | RQDNHQKWXFACIW-ZKAFIRSWSA-N |
| XLogP | 8.79 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.91 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|