C45H82NO7P — CID 165336266
[3-[(Z)-henicos-11-enoxy]-2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 165336266) has the molecular formula C45H82NO7P and a molecular weight of 780.12 g/mol. Its IUPAC name is [3-[(Z)-henicos-11-enoxy]-2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-[(Z)-henicos-11-enoxy]-2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 165336266 |
| Molecular Formula | C45H82NO7P |
| Molecular Weight | 780.12 g/mol |
| Exact Mass | 779.58 |
| IUPAC Name | [3-[(Z)-henicos-11-enoxy]-2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(COCCCCCCCCCC/C=C\CCCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C45H82NO7P/c1-6-8-10-12-14-16-18-20-21-22-23-24-25-27-29-31-33-35-37-40-50-42-44(43-52-54(48,49)51-41-39-46(3,4)5)53-45(47)38-36-34-32-30-28-26-19-17-15-13-11-9-7-2/h9,11,15,17,21-22,26,28,32,34,44H,6-8,10,12-14,16,18-20,23-25,27,29-31,33,35-43H2,1-5H3/b11-9-,17-15-,22-21-,28-26-,34-32- |
| InChIKey | ZNZSGCKNHXEEHK-RESNCWQUSA-N |
| XLogP | 11.92 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.12 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|