C33H58O12S — CID 165188729
[1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]propan-2-yl] butanoate (PubChem CID 165188729) has the molecular formula C33H58O12S and a molecular weight of 678.88 g/mol. Its IUPAC name is [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]propan-2-yl] butanoate.
| Compound Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]propan-2-yl] butanoate |
|---|---|
| PubChem CID | 165188729 |
| Molecular Formula | C33H58O12S |
| Molecular Weight | 678.88 g/mol |
| Exact Mass | 678.36 |
| IUPAC Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]propan-2-yl] butanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCCOCC(COC1OC(CO)C(O)C(OS(=O)(=O)O)C1O)OC(=O)CCC |
| InChI | InChI=1S/C33H58O12S/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-41-25-27(43-29(35)22-4-2)26-42-33-31(37)32(45-46(38,39)40)30(36)28(24-34)44-33/h5-6,8-9,11-12,27-28,30-34,36-37H,3-4,7,10,13-26H2,1-2H3,(H,38,39,40)/b6-5-,9-8-,12-11- |
| InChIKey | BFVWJLJYAYHXNV-AGRJPVHOSA-N |
| XLogP | 4.73 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.88 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|