C18H16F3N3O5S — CID 16519820
3-(2-oxo-3H-benzimidazol-1-yl)propyl 2-[(2,3,4-trifluorophenyl)sulfonylamino]acetate (PubChem CID 16519820) has the molecular formula C18H16F3N3O5S and a molecular weight of 443.40 g/mol. Its IUPAC name is 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2-[(2,3,4-trifluorophenyl)sulfonylamino]acetate.
| Compound Name | 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2-[(2,3,4-trifluorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 16519820 |
| Molecular Formula | C18H16F3N3O5S |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2-[(2,3,4-trifluorophenyl)sulfonylamino]acetate |
| SMILES | O=C(CNS(=O)(=O)c1ccc(F)c(F)c1F)OCCCn1c(=O)[nH]c2ccccc21 |
| InChI | InChI=1S/C18H16F3N3O5S/c19-11-6-7-14(17(21)16(11)20)30(27,28)22-10-15(25)29-9-3-8-24-13-5-2-1-4-12(13)23-18(24)26/h1-2,4-7,22H,3,8-10H2,(H,23,26) |
| InChIKey | CDUFILATZNEGMP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|