C48H80O12S — CID 165199055
[1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(Z)-tridec-9-enoxy]propan-2-yl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate (PubChem CID 165199055) has the molecular formula C48H80O12S and a molecular weight of 881.22 g/mol. Its IUPAC name is [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(Z)-tridec-9-enoxy]propan-2-yl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate.
| Compound Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(Z)-tridec-9-enoxy]propan-2-yl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate |
|---|---|
| PubChem CID | 165199055 |
| Molecular Formula | C48H80O12S |
| Molecular Weight | 881.22 g/mol |
| Exact Mass | 880.54 |
| IUPAC Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(Z)-tridec-9-enoxy]propan-2-yl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)OC(COCCCCCCCC/C=C\CCC)COC1OC(CO)C(O)C(OS(=O)(=O)O)C1O |
| InChI | InChI=1S/C48H80O12S/c1-3-5-7-9-11-13-15-16-17-18-19-20-21-22-23-24-25-26-27-29-31-33-35-37-44(50)58-42(40-56-38-36-34-32-30-28-14-12-10-8-6-4-2)41-57-48-46(52)47(60-61(53,54)55)45(51)43(39-49)59-48/h5,7-8,10-11,13,16-17,19-20,22-23,25-26,42-43,45-49,51-52H,3-4,6,9,12,14-15,18,21,24,27-41H2,1-2H3,(H,53,54,55)/b7-5-,10-8-,13-11-,17-16-,20-19-,23-22-,26-25- |
| InChIKey | CUUZVGNXAOXHBM-DJHNAPAOSA-N |
| XLogP | 9.68 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.22 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|