C49H80NO8P — CID 165204263
[3-[2-[[(5Z,8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-5,8,11,14,17,20,23-heptaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 165204263) has the molecular formula C49H80NO8P and a molecular weight of 842.15 g/mol. Its IUPAC name is [3-[2-[[(5Z,8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-5,8,11,14,17,20,23-heptaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [3-[2-[[(5Z,8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-5,8,11,14,17,20,23-heptaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 165204263 |
| Molecular Formula | C49H80NO8P |
| Molecular Weight | 842.15 g/mol |
| Exact Mass | 841.56 |
| IUPAC Name | [3-[2-[[(5Z,8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-5,8,11,14,17,20,23-heptaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C49H80NO8P/c1-3-5-7-9-11-13-15-17-19-20-21-22-23-24-25-26-28-29-31-33-35-37-39-41-48(52)50-43-44-57-59(54,55)58-46-47(51)45-56-49(53)42-40-38-36-34-32-30-27-18-16-14-12-10-8-6-4-2/h5,7,11-14,17-19,21-22,24-25,27-29,33,35,47,51H,3-4,6,8-10,15-16,20,23,26,30-32,34,36-46H2,1-2H3,(H,50,52)(H,54,55)/b7-5-,13-11-,14-12-,19-17-,22-21-,25-24-,27-18-,29-28-,35-33- |
| InChIKey | DPRVWDUWEPOTHI-YTVFIIQRSA-N |
| XLogP | 12.77 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.15 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|