C47H82NO8P — CID 165295455
[3-[2-[[(Z)-hexadec-9-enoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (11Z,14Z,17Z,20Z,23Z)-hexacosa-11,14,17,20,23-pentaenoate (PubChem CID 165295455) has the molecular formula C47H82NO8P and a molecular weight of 820.15 g/mol. Its IUPAC name is [3-[2-[[(Z)-hexadec-9-enoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (11Z,14Z,17Z,20Z,23Z)-hexacosa-11,14,17,20,23-pentaenoate.
| Compound Name | [3-[2-[[(Z)-hexadec-9-enoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (11Z,14Z,17Z,20Z,23Z)-hexacosa-11,14,17,20,23-pentaenoate |
|---|---|
| PubChem CID | 165295455 |
| Molecular Formula | C47H82NO8P |
| Molecular Weight | 820.15 g/mol |
| Exact Mass | 819.58 |
| IUPAC Name | [3-[2-[[(Z)-hexadec-9-enoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (11Z,14Z,17Z,20Z,23Z)-hexacosa-11,14,17,20,23-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)OCC(O)COP(=O)(O)OCCNC(=O)CCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C47H82NO8P/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-23-24-25-26-28-30-32-34-36-38-40-47(51)54-43-45(49)44-56-57(52,53)55-42-41-48-46(50)39-37-35-33-31-29-27-16-14-12-10-8-6-4-2/h5,7,11,13-14,16-18,20-21,23-24,45,49H,3-4,6,8-10,12,15,19,22,25-44H2,1-2H3,(H,48,50)(H,52,53)/b7-5-,13-11-,16-14-,18-17-,21-20-,24-23- |
| InChIKey | SNMOHOBTXIGQGN-XCELFCIUSA-N |
| XLogP | 12.66 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.15 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|