C46H78NO8P — CID 165247544
[3-[2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-pentadec-9-enoate (PubChem CID 165247544) has the molecular formula C46H78NO8P and a molecular weight of 804.10 g/mol. Its IUPAC name is [3-[2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-pentadec-9-enoate.
| Compound Name | [3-[2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-pentadec-9-enoate |
|---|---|
| PubChem CID | 165247544 |
| Molecular Formula | C46H78NO8P |
| Molecular Weight | 804.10 g/mol |
| Exact Mass | 803.55 |
| IUPAC Name | [3-[2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-pentadec-9-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CCCCCCC/C=C\CCCCC |
| InChI | InChI=1S/C46H78NO8P/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-23-24-25-26-27-28-30-32-34-36-38-45(49)47-40-41-54-56(51,52)55-43-44(48)42-53-46(50)39-37-35-33-31-29-16-14-12-10-8-6-4-2/h5,7,11-14,17-18,20-21,23-24,26-27,44,48H,3-4,6,8-10,15-16,19,22,25,28-43H2,1-2H3,(H,47,49)(H,51,52)/b7-5-,13-11-,14-12-,18-17-,21-20-,24-23-,27-26- |
| InChIKey | LFYYHMYVDQFMQZ-JSQURJFFSA-N |
| XLogP | 12.05 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.10 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|