C49H92NO7P — CID 165235338
[3-[(11Z,14Z)-henicosa-11,14-dienoxy]-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 165235338) has the molecular formula C49H92NO7P and a molecular weight of 838.25 g/mol. Its IUPAC name is [3-[(11Z,14Z)-henicosa-11,14-dienoxy]-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-[(11Z,14Z)-henicosa-11,14-dienoxy]-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 165235338 |
| Molecular Formula | C49H92NO7P |
| Molecular Weight | 838.25 g/mol |
| Exact Mass | 837.66 |
| IUPAC Name | [3-[(11Z,14Z)-henicosa-11,14-dienoxy]-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC(COCCCCCCCCCC/C=C\C/C=C\CCCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C49H92NO7P/c1-6-8-10-12-14-16-18-20-22-24-25-27-29-31-33-35-37-39-41-44-54-46-48(47-56-58(52,53)55-45-43-50(3,4)5)57-49(51)42-40-38-36-34-32-30-28-26-23-21-19-17-15-13-11-9-7-2/h15-18,21-24,48H,6-14,19-20,25-47H2,1-5H3/b17-15-,18-16-,23-21-,24-22- |
| InChIKey | JJNGIDKRWZCLHW-MLLZQYMOSA-N |
| XLogP | 13.70 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.25 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|