C42H83NO7P+ — CID 165261749
2-[hydroxy-[3-[(Z)-icos-11-enoxy]-2-[(Z)-tetradec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 165261749) has the molecular formula C42H83NO7P+ and a molecular weight of 745.10 g/mol. Its IUPAC name is 2-[hydroxy-[3-[(Z)-icos-11-enoxy]-2-[(Z)-tetradec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[3-[(Z)-icos-11-enoxy]-2-[(Z)-tetradec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 165261749 |
| Molecular Formula | C42H83NO7P+ |
| Molecular Weight | 745.10 g/mol |
| Exact Mass | 744.59 |
| IUPAC Name | 2-[hydroxy-[3-[(Z)-icos-11-enoxy]-2-[(Z)-tetradec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OC(COCCCCCCCCCC/C=C\CCCCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C42H82NO7P/c1-6-8-10-12-14-16-18-19-20-21-22-23-24-26-28-30-32-34-37-47-39-41(40-49-51(45,46)48-38-36-43(3,4)5)50-42(44)35-33-31-29-27-25-17-15-13-11-9-7-2/h13,15,19-20,41H,6-12,14,16-18,21-40H2,1-5H3/p+1/b15-13-,20-19- |
| InChIKey | NKIBJFPQJIJEEL-SESCJMQFSA-O |
| XLogP | 12.05 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.10 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|