C24H24FNO7 — CID 16526186
dimethyl 5-[[2-[1-(3-fluorophenyl)cyclopentanecarbonyl]oxyacetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 16526186) has the molecular formula C24H24FNO7 and a molecular weight of 457.45 g/mol. Its IUPAC name is dimethyl 5-[[2-[1-(3-fluorophenyl)cyclopentanecarbonyl]oxyacetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-[1-(3-fluorophenyl)cyclopentanecarbonyl]oxyacetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 16526186 |
| Molecular Formula | C24H24FNO7 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | dimethyl 5-[[2-[1-(3-fluorophenyl)cyclopentanecarbonyl]oxyacetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)COC(=O)C2(c3cccc(F)c3)CCCC2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C24H24FNO7/c1-31-21(28)15-10-16(22(29)32-2)12-19(11-15)26-20(27)14-33-23(30)24(8-3-4-9-24)17-6-5-7-18(25)13-17/h5-7,10-13H,3-4,8-9,14H2,1-2H3,(H,26,27) |
| InChIKey | RGABDMIRICQPFY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|