C20H22ClN3O4S2 — CID 16526369
3-[5-[2-(3-chlorophenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]-N,N-diethylbenzenesulfonamide (PubChem CID 16526369) has the molecular formula C20H22ClN3O4S2 and a molecular weight of 468.00 g/mol. Its IUPAC name is 3-[5-[2-(3-chlorophenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 3-[5-[2-(3-chlorophenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 16526369 |
| Molecular Formula | C20H22ClN3O4S2 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 3-[5-[2-(3-chlorophenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2nnc(SCCOc3cccc(Cl)c3)o2)c1 |
| InChI | InChI=1S/C20H22ClN3O4S2/c1-3-24(4-2)30(25,26)18-10-5-7-15(13-18)19-22-23-20(28-19)29-12-11-27-17-9-6-8-16(21)14-17/h5-10,13-14H,3-4,11-12H2,1-2H3 |
| InChIKey | LLOZGIQYKMZTCX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|