C16H24N4O5S3 — CID 56528929
N,N-diethyl-3-[5-[3-(methylsulfamoyl)propylsulfanyl]-1,3,4-oxadiazol-2-yl]benzenesulfonamide (PubChem CID 56528929) has the molecular formula C16H24N4O5S3 and a molecular weight of 448.59 g/mol. Its IUPAC name is N,N-diethyl-3-[5-[3-(methylsulfamoyl)propylsulfanyl]-1,3,4-oxadiazol-2-yl]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-[5-[3-(methylsulfamoyl)propylsulfanyl]-1,3,4-oxadiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 56528929 |
| Molecular Formula | C16H24N4O5S3 |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | N,N-diethyl-3-[5-[3-(methylsulfamoyl)propylsulfanyl]-1,3,4-oxadiazol-2-yl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2nnc(SCCCS(=O)(=O)NC)o2)c1 |
| InChI | InChI=1S/C16H24N4O5S3/c1-4-20(5-2)28(23,24)14-9-6-8-13(12-14)15-18-19-16(25-15)26-10-7-11-27(21,22)17-3/h6,8-9,12,17H,4-5,7,10-11H2,1-3H3 |
| InChIKey | HSXHHMPUAZAANT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|