C20H22FN3O4S2 — CID 35721645
N,N-diethyl-3-[5-[2-(2-fluorophenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]benzenesulfonamide (PubChem CID 35721645) has the molecular formula C20H22FN3O4S2 and a molecular weight of 451.55 g/mol. Its IUPAC name is N,N-diethyl-3-[5-[2-(2-fluorophenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-[5-[2-(2-fluorophenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 35721645 |
| Molecular Formula | C20H22FN3O4S2 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N,N-diethyl-3-[5-[2-(2-fluorophenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2nnc(SCCOc3ccccc3F)o2)c1 |
| InChI | InChI=1S/C20H22FN3O4S2/c1-3-24(4-2)30(25,26)16-9-7-8-15(14-16)19-22-23-20(28-19)29-13-12-27-18-11-6-5-10-17(18)21/h5-11,14H,3-4,12-13H2,1-2H3 |
| InChIKey | NPKYDTXIYXKZOQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|