C21H22N2O3 — CID 16528025
[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 3,3-diphenylpropanoate (PubChem CID 16528025) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 3,3-diphenylpropanoate.
| Compound Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 16528025 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 3,3-diphenylpropanoate |
| SMILES | CN(CCC#N)C(=O)COC(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O3/c1-23(14-8-13-22)20(24)16-26-21(25)15-19(17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-7,9-12,19H,8,14-16H2,1H3 |
| InChIKey | WDJYDOHYZZWCOT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |