C18H10ClF4NO3S — CID 16529198
[1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate (PubChem CID 16529198) has the molecular formula C18H10ClF4NO3S and a molecular weight of 431.79 g/mol. Its IUPAC name is [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate.
| Compound Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 16529198 |
| Molecular Formula | C18H10ClF4NO3S |
| Molecular Weight | 431.79 g/mol |
| Exact Mass | 431.00 |
| IUPAC Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate |
| SMILES | CC(OC(=O)c1sc2cc(F)ccc2c1Cl)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H10ClF4NO3S/c1-7(17(25)24-11-5-4-10(21)14(22)15(11)23)27-18(26)16-13(19)9-3-2-8(20)6-12(9)28-16/h2-7H,1H3,(H,24,25) |
| InChIKey | YSLLYMXFSBBYCD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.79 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|