C39H71N2O7P — CID 165300949
2-aminoethyl [(4E,8E,12E)-3-hydroxy-2-[[(10Z,12Z)-3-hydroxyoctadeca-10,12-dienoyl]amino]nonadeca-4,8,12-trienyl] hydrogen phosphate (PubChem CID 165300949) has the molecular formula C39H71N2O7P and a molecular weight of 710.98 g/mol. Its IUPAC name is 2-aminoethyl [(4E,8E,12E)-3-hydroxy-2-[[(10Z,12Z)-3-hydroxyoctadeca-10,12-dienoyl]amino]nonadeca-4,8,12-trienyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [(4E,8E,12E)-3-hydroxy-2-[[(10Z,12Z)-3-hydroxyoctadeca-10,12-dienoyl]amino]nonadeca-4,8,12-trienyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165300949 |
| Molecular Formula | C39H71N2O7P |
| Molecular Weight | 710.98 g/mol |
| Exact Mass | 710.50 |
| IUPAC Name | 2-aminoethyl [(4E,8E,12E)-3-hydroxy-2-[[(10Z,12Z)-3-hydroxyoctadeca-10,12-dienoyl]amino]nonadeca-4,8,12-trienyl] hydrogen phosphate |
| SMILES | CCCCC/C=C\C=C/CCCCCCC(O)CC(=O)NC(COP(=O)(O)OCCN)C(O)/C=C/CC/C=C/CC/C=C/CCCCCC |
| InChI | InChI=1S/C39H71N2O7P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-38(43)37(35-48-49(45,46)47-33-32-40)41-39(44)34-36(42)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h12-16,18,21,23,29,31,36-38,42-43H,3-11,17,19-20,22,24-28,30,32-35,40H2,1-2H3,(H,41,44)(H,45,46)/b14-12-,15-13+,18-16-,23-21+,31-29+ |
| InChIKey | UDCGMEIJDREBRR-XRZQNGRFSA-N |
| XLogP | 8.91 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.98 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|