C20H21ClN2O5 — CID 16532605
[1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 2-[(2-chlorophenyl)methoxy]benzoate (PubChem CID 16532605) has the molecular formula C20H21ClN2O5 and a molecular weight of 404.85 g/mol. Its IUPAC name is [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 2-[(2-chlorophenyl)methoxy]benzoate.
| Compound Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 2-[(2-chlorophenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 16532605 |
| Molecular Formula | C20H21ClN2O5 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 2-[(2-chlorophenyl)methoxy]benzoate |
| SMILES | CCNC(=O)NC(=O)C(C)OC(=O)c1ccccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C20H21ClN2O5/c1-3-22-20(26)23-18(24)13(2)28-19(25)15-9-5-7-11-17(15)27-12-14-8-4-6-10-16(14)21/h4-11,13H,3,12H2,1-2H3,(H2,22,23,24,26) |
| InChIKey | YQALJOSEAIAJEE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |