C49H91O9P — CID 165333238
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-henicos-11-enoxy]propan-2-yl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate (PubChem CID 165333238) has the molecular formula C49H91O9P and a molecular weight of 855.23 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-henicos-11-enoxy]propan-2-yl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-henicos-11-enoxy]propan-2-yl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate |
|---|---|
| PubChem CID | 165333238 |
| Molecular Formula | C49H91O9P |
| Molecular Weight | 855.23 g/mol |
| Exact Mass | 854.64 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-henicos-11-enoxy]propan-2-yl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCCCCC(=O)OC(COCCCCCCCCCC/C=C\CCCCCCCCC)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C49H91O9P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-49(52)58-48(46-57-59(53,54)56-44-47(51)43-50)45-55-42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11,13,17,19-20,22-23,25,47-48,50-51H,3-10,12,14-16,18,21,24,26-46H2,1-2H3,(H,53,54)/b13-11-,19-17-,22-20-,25-23- |
| InChIKey | ZCDOSXXDKQKSFS-BXTJNSCGSA-N |
| XLogP | 13.76 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.23 |
| LogP ≤ 5 | 13.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|