C26H39IN2O2Si — CID 165340656
tert-butyl-[(R)-[(2S,4S,5R)-5-(2-iodoethyl)-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methoxy]-dimethylsilane (PubChem CID 165340656) has the molecular formula C26H39IN2O2Si and a molecular weight of 566.60 g/mol. Its IUPAC name is tert-butyl-[(R)-[(2S,4S,5R)-5-(2-iodoethyl)-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(R)-[(2S,4S,5R)-5-(2-iodoethyl)-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 165340656 |
| Molecular Formula | C26H39IN2O2Si |
| Molecular Weight | 566.60 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | tert-butyl-[(R)-[(2S,4S,5R)-5-(2-iodoethyl)-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methoxy]-dimethylsilane |
| SMILES | COc1ccc2nccc([C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3C[C@@H]4CCN3C[C@@H]4CCI)c2c1 |
| InChI | InChI=1S/C26H39IN2O2Si/c1-26(2,3)32(5,6)31-25(24-15-18-11-14-29(24)17-19(18)9-12-27)21-10-13-28-23-8-7-20(30-4)16-22(21)23/h7-8,10,13,16,18-19,24-25H,9,11-12,14-15,17H2,1-6H3/t18-,19-,24-,25+/m0/s1 |
| InChIKey | BSYWQCFGEIYSMY-QXVOXHNYSA-N |
| XLogP | 6.84 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.60 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|