C26H38N2O2Si — CID 75990069
tert-butyl-[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methoxy]-dimethylsilane (PubChem CID 75990069) has the molecular formula C26H38N2O2Si and a molecular weight of 438.69 g/mol. Its IUPAC name is tert-butyl-[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 75990069 |
| Molecular Formula | C26H38N2O2Si |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | tert-butyl-[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methoxy]-dimethylsilane |
| SMILES | C=CC1CN2CCC1CC2C(O[Si](C)(C)C(C)(C)C)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C26H38N2O2Si/c1-8-18-17-28-14-12-19(18)15-24(28)25(30-31(6,7)26(2,3)4)21-11-13-27-23-10-9-20(29-5)16-22(21)23/h8-11,13,16,18-19,24-25H,1,12,14-15,17H2,2-7H3 |
| InChIKey | OTISBPJYARKHDK-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|