C11H7Cl2NOS — CID 165347289
4-[(4,5-dichlorothiophen-2-yl)methylideneamino]phenol (PubChem CID 165347289) has the molecular formula C11H7Cl2NOS and a molecular weight of 272.16 g/mol. Its IUPAC name is 4-[(4,5-dichlorothiophen-2-yl)methylideneamino]phenol.
| Compound Name | 4-[(4,5-dichlorothiophen-2-yl)methylideneamino]phenol |
|---|---|
| PubChem CID | 165347289 |
| Molecular Formula | C11H7Cl2NOS |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | 4-[(4,5-dichlorothiophen-2-yl)methylideneamino]phenol |
| SMILES | Oc1ccc(/N=C/c2cc(Cl)c(Cl)s2)cc1 |
| InChI | InChI=1S/C11H7Cl2NOS/c12-10-5-9(16-11(10)13)6-14-7-1-3-8(15)4-2-7/h1-6,15H/b14-6+ |
| InChIKey | PYPHCUQMUTZAIN-MKMNVTDBSA-N |
| XLogP | 4.51 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|