C10H8N2O2 — CID 165349723
5-ethoxy-2-hydroxybenzene-1,3-dicarbonitrile (PubChem CID 165349723) has the molecular formula C10H8N2O2 and a molecular weight of 188.19 g/mol. Its IUPAC name is 5-ethoxy-2-hydroxybenzene-1,3-dicarbonitrile.
| Compound Name | 5-ethoxy-2-hydroxybenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 165349723 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 5-ethoxy-2-hydroxybenzene-1,3-dicarbonitrile |
| SMILES | CCOc1cc(C#N)c(O)c(C#N)c1 |
| InChI | InChI=1S/C10H8N2O2/c1-2-14-9-3-7(5-11)10(13)8(4-9)6-12/h3-4,13H,2H2,1H3 |
| InChIKey | UZPVWFCCBGWZEV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |