About N-(2-chloro-5-methylphenyl)-2,2-dimethyloxolan-3-amine
N-(2-chloro-5-methylphenyl)-2,2-dimethyloxolan-3-amine (PubChem CID 165350899) has the molecular formula C13H18ClNO
and a molecular weight of 239.75 g/mol. Its IUPAC name is N-(2-chloro-5-methylphenyl)-2,2-dimethyloxolan-3-amine.
Molecular Properties
| Compound Name | N-(2-chloro-5-methylphenyl)-2,2-dimethyloxolan-3-amine |
| PubChem CID | 165350899 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-(2-chloro-5-methylphenyl)-2,2-dimethyloxolan-3-amine |
| SMILES | Cc1ccc(Cl)c(NC2CCOC2(C)C)c1 |
| InChI | InChI=1S/C13H18ClNO/c1-9-4-5-10(14)11(8-9)15-12-6-7-16-13(12,2)3/h4-5,8,12,15H,6-7H2,1-3H3 |
| InChIKey | ZZNVJMMKHTXJMR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-chloro-5-methylphenyl)-2,2-dimethyloxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloro-5-methylphenyl)-2,2-dimethyloxolan-3-amine?
The IUPAC name of N-(2-chloro-5-methylphenyl)-2,2-dimethyloxolan-3-amine (CID 165350899) is N-(2-chloro-5-methylphenyl)-2,2-dimethyloxolan-3-amine.
What is the SMILES notation for N-(2-chloro-5-methylphenyl)-2,2-dimethyloxolan-3-amine?
The canonical SMILES for N-(2-chloro-5-methylphenyl)-2,2-dimethyloxolan-3-amine is Cc1ccc(Cl)c(NC2CCOC2(C)C)c1.
What is the InChIKey of N-(2-chloro-5-methylphenyl)-2,2-dimethyloxolan-3-amine?
The InChIKey is ZZNVJMMKHTXJMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClNO/c1-9-4-5-10(14)11(8-9)15-12-6-7-16-13(12,2)3/h4-5,8,12,15H,6-7H2,1-3H3.
What are the key properties of N-(2-chloro-5-methylphenyl)-2,2-dimethyloxolan-3-amine?
N-(2-chloro-5-methylphenyl)-2,2-dimethyloxolan-3-amine has a molecular weight of 239.75 g/mol, XLogP of 3.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloro-5-methylphenyl)-2,2-dimethyloxolan-3-amine is sourced from PubChem (CID 165350899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).