C13H18ClNO — CID 165350899
N-(2-chloro-5-methylphenyl)-2,2-dimethyloxolan-3-amine (PubChem CID 165350899) has the molecular formula C13H18ClNO and a molecular weight of 239.75 g/mol. Its IUPAC name is N-(2-chloro-5-methylphenyl)-2,2-dimethyloxolan-3-amine.
| Compound Name | N-(2-chloro-5-methylphenyl)-2,2-dimethyloxolan-3-amine |
|---|---|
| PubChem CID | 165350899 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-(2-chloro-5-methylphenyl)-2,2-dimethyloxolan-3-amine |
| SMILES | Cc1ccc(Cl)c(NC2CCOC2(C)C)c1 |
| InChI | InChI=1S/C13H18ClNO/c1-9-4-5-10(14)11(8-9)15-12-6-7-16-13(12,2)3/h4-5,8,12,15H,6-7H2,1-3H3 |
| InChIKey | ZZNVJMMKHTXJMR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |