C13H22N2O — CID 165351264
11-ethyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 165351264) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 11-ethyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | 11-ethyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 165351264 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 11-ethyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | CCN1CC2CC(C1)C1CCCC(=O)N1C2 |
| InChI | InChI=1S/C13H22N2O/c1-2-14-7-10-6-11(9-14)12-4-3-5-13(16)15(12)8-10/h10-12H,2-9H2,1H3 |
| InChIKey | LRDWBDXBFHPTGD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |